C15H19NO5S — CID 7518089
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 7518089) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 7518089 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | CN(c1ccc(C(=O)COC(=O)C2CCC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H19NO5S/c1-16(22(2,19)20)13-8-6-11(7-9-13)14(17)10-21-15(18)12-4-3-5-12/h6-9,12H,3-5,10H2,1-2H3 |
| InChIKey | NLLKAFLBNITQQH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |