C17H19NO6S — CID 9487434
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 3-(furan-2-yl)propanoate (PubChem CID 9487434) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 3-(furan-2-yl)propanoate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 9487434 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 3-(furan-2-yl)propanoate |
| SMILES | CN(c1ccc(C(=O)COC(=O)CCc2ccco2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H19NO6S/c1-18(25(2,21)22)14-7-5-13(6-8-14)16(19)12-24-17(20)10-9-15-4-3-11-23-15/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | VRFVKXLHWHHBLI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |