C14H16N2O4S — CID 61131132
3-(furan-2-yl)-N-methyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 61131132) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-methyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-(furan-2-yl)-N-methyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 61131132 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-(furan-2-yl)-N-methyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CN(C(=O)CCc1ccco1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-16(14(17)9-6-12-3-2-10-20-12)11-4-7-13(8-5-11)21(15,18)19/h2-5,7-8,10H,6,9H2,1H3,(H2,15,18,19) |
| InChIKey | SVYUYJKPOCPDOK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |