C19H21NO5S2 — CID 9458738
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 9458738) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 9458738 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)OCC(=O)c1ccc(N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21NO5S2/c1-14(26-17-7-5-4-6-8-17)19(22)25-13-18(21)15-9-11-16(12-10-15)20(2)27(3,23)24/h4-12,14H,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | IXKROEGVAQACEO-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |