About [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate
[2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 2418966) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate.
Analyze [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate?
The IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate (CID 2418966) is [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate?
The canonical SMILES for [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate is Cc1ccc(C(=O)COC(=O)C2CCC2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate?
The InChIKey is KAAGPDYJBLIQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-10-6-7-13(8-11(10)2)14(16)9-18-15(17)12-4-3-5-12/h6-8,12H,3-5,9H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate?
[2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate has a molecular weight of 246.31 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-2-oxoethyl] cyclobutanecarboxylate is sourced from PubChem (CID 2418966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).