C16H21NO5 — CID 174964194
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] piperidine-4-carboxylate (PubChem CID 174964194) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] piperidine-4-carboxylate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] piperidine-4-carboxylate |
|---|---|
| PubChem CID | 174964194 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] piperidine-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)C2CCNCC2)cc1OC |
| InChI | InChI=1S/C16H21NO5/c1-20-14-4-3-12(9-15(14)21-2)13(18)10-22-16(19)11-5-7-17-8-6-11/h3-4,9,11,17H,5-8,10H2,1-2H3 |
| InChIKey | AEGBIFIVYFSTED-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |