C20H24O5 — CID 11894258
3-O-[2-(3,4-dimethylphenyl)-2-oxoethyl] 2-O-methyl (1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 11894258) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-O-[2-(3,4-dimethylphenyl)-2-oxoethyl] 2-O-methyl (1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | 3-O-[2-(3,4-dimethylphenyl)-2-oxoethyl] 2-O-methyl (1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11894258 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-O-[2-(3,4-dimethylphenyl)-2-oxoethyl] 2-O-methyl (1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2CC[C@H](C2)[C@H]1C(=O)OCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H24O5/c1-11-4-5-13(8-12(11)2)16(21)10-25-20(23)18-15-7-6-14(9-15)17(18)19(22)24-3/h4-5,8,14-15,17-18H,6-7,9-10H2,1-3H3/t14-,15+,17-,18+/m0/s1 |
| InChIKey | YRBNSWZOGGWIHV-CIRFHOKZSA-N |
| XLogP | 2.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |