C21H22O6 — CID 100884319
7-O-[2-(4-methoxyphenyl)-2-oxoethyl] 6-O-methyl (1S,2R,4R,5S,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate (PubChem CID 100884319) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 7-O-[2-(4-methoxyphenyl)-2-oxoethyl] 6-O-methyl (1S,2R,4R,5S,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate.
| Compound Name | 7-O-[2-(4-methoxyphenyl)-2-oxoethyl] 6-O-methyl (1S,2R,4R,5S,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 100884319 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 7-O-[2-(4-methoxyphenyl)-2-oxoethyl] 6-O-methyl (1S,2R,4R,5S,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]3C[C@@H]23)[C@@H]1C(=O)OCC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H22O6/c1-25-12-5-3-11(4-6-12)17(22)10-27-21(24)19-14-8-7-13(15-9-16(14)15)18(19)20(23)26-2/h3-8,13-16,18-19H,9-10H2,1-2H3/t13-,14-,15-,16-,18+,19-/m0/s1 |
| InChIKey | ONFSNMPRGOMFHO-SCVNYCPESA-N |
| XLogP | 2.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|