C26H29NO6 — CID 124716243
[2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]hexanoate (PubChem CID 124716243) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]hexanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]hexanoate |
|---|---|
| PubChem CID | 124716243 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]hexanoate |
| SMILES | CCCC[C@H](C(=O)OCC(=O)c1ccc(OC)cc1)N1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@H]34)[C@H]2C1=O |
| InChI | InChI=1S/C26H29NO6/c1-3-4-5-20(26(31)33-13-21(28)14-6-8-15(32-2)9-7-14)27-24(29)22-16-10-11-17(19-12-18(16)19)23(22)25(27)30/h6-11,16-20,22-23H,3-5,12-13H2,1-2H3/t16-,17-,18-,19+,20+,22+,23+/m0/s1 |
| InChIKey | QZGASFHHGGCKLT-UEJPSOMASA-N |
| XLogP | 3.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|