C28H24ClNO5 — CID 2906533
[2-(4-chlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-phenylpropanoate (PubChem CID 2906533) has the molecular formula C28H24ClNO5 and a molecular weight of 489.96 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-phenylpropanoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2906533 |
| Molecular Formula | C28H24ClNO5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)N1C(=O)C2C3C=CC(C4CC34)C2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24ClNO5/c29-17-8-6-16(7-9-17)23(31)14-35-28(34)22(12-15-4-2-1-3-5-15)30-26(32)24-18-10-11-19(21-13-20(18)21)25(24)27(30)33/h1-11,18-22,24-25H,12-14H2 |
| InChIKey | XHRQGGIIPBOCPF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|