C26H22FNO5 — CID 124714935
[2-(4-fluorophenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate (PubChem CID 124714935) has the molecular formula C26H22FNO5 and a molecular weight of 447.46 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 124714935 |
| Molecular Formula | C26H22FNO5 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate |
| SMILES | O=C(COC(=O)[C@H](Cc1ccccc1)N1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H22FNO5/c27-19-10-8-16(9-11-19)21(29)14-33-26(32)20(12-15-4-2-1-3-5-15)28-24(30)22-17-6-7-18(13-17)23(22)25(28)31/h1-11,17-18,20,22-23H,12-14H2/t17-,18-,20-,22+,23+/m0/s1 |
| InChIKey | NIYLGXYPKDADMD-SYNMBVLASA-N |
| XLogP | 2.97 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|