C27H25NO6 — CID 124723841
[2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate (PubChem CID 124723841) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 124723841 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanoate |
| SMILES | COc1cccc(C(=O)COC(=O)C(Cc2ccccc2)N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c1 |
| InChI | InChI=1S/C27H25NO6/c1-33-20-9-5-8-17(14-20)22(29)15-34-27(32)21(12-16-6-3-2-4-7-16)28-25(30)23-18-10-11-19(13-18)24(23)26(28)31/h2-11,14,18-19,21,23-24H,12-13,15H2,1H3/t18-,19-,21?,23+,24+/m0/s1 |
| InChIKey | XIFSVJBSGJOGLU-NAZYGMDKSA-N |
| XLogP | 2.84 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|