C24H27Br2NO6 — CID 98468974
[2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate (PubChem CID 98468974) has the molecular formula C24H27Br2NO6 and a molecular weight of 585.29 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 98468974 |
| Molecular Formula | C24H27Br2NO6 |
| Molecular Weight | 585.29 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate |
| SMILES | COc1ccc(C(=O)COC(=O)[C@H](CC(C)C)N2C(=O)[C@@H]3[C@@H]4C[C@H]([C@H](Br)[C@@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H27Br2NO6/c1-11(2)8-16(24(31)33-10-17(28)12-4-6-13(32-3)7-5-12)27-22(29)18-14-9-15(19(18)23(27)30)21(26)20(14)25/h4-7,11,14-16,18-21H,8-10H2,1-3H3/t14-,15-,16-,18-,19+,20-,21+/m0/s1 |
| InChIKey | BXRRFGLHOMHOQQ-TWUNARIMSA-N |
| XLogP | 3.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|