C23H25Br2NO5 — CID 124724392
phenacyl (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate (PubChem CID 124724392) has the molecular formula C23H25Br2NO5 and a molecular weight of 555.26 g/mol. Its IUPAC name is phenacyl (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate.
| Compound Name | phenacyl (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 124724392 |
| Molecular Formula | C23H25Br2NO5 |
| Molecular Weight | 555.26 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | phenacyl (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCC(=O)c1ccccc1)N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O |
| InChI | InChI=1S/C23H25Br2NO5/c1-11(2)8-15(23(30)31-10-16(27)12-6-4-3-5-7-12)26-21(28)17-13-9-14(18(17)22(26)29)20(25)19(13)24/h3-7,11,13-15,17-20H,8-10H2,1-2H3/t13-,14-,15-,17-,18-,19+,20+/m1/s1 |
| InChIKey | YXDAJQSJJCZMDB-CJSYXLNHSA-N |
| XLogP | 3.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|