C24H19Br2NO5 — CID 3448841
phenacyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate (PubChem CID 3448841) has the molecular formula C24H19Br2NO5 and a molecular weight of 561.23 g/mol. Its IUPAC name is phenacyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate.
| Compound Name | phenacyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
|---|---|
| PubChem CID | 3448841 |
| Molecular Formula | C24H19Br2NO5 |
| Molecular Weight | 561.23 g/mol |
| Exact Mass | 558.96 |
| IUPAC Name | phenacyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)C2C3CC(C(Br)C3Br)C2C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H19Br2NO5/c25-20-14-10-15(21(20)26)19-18(14)22(29)27(23(19)30)16-9-5-4-8-13(16)24(31)32-11-17(28)12-6-2-1-3-7-12/h1-9,14-15,18-21H,10-11H2 |
| InChIKey | SXFHBOXRMAKKMA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|