C25H21Br2NO5 — CID 124776225
[2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124776225) has the molecular formula C25H21Br2NO5 and a molecular weight of 575.25 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124776225 |
| Molecular Formula | C25H21Br2NO5 |
| Molecular Weight | 575.25 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H21Br2NO5/c1-12-6-8-13(9-7-12)18(29)11-33-25(32)14-4-2-3-5-17(14)28-23(30)19-15-10-16(20(19)24(28)31)22(27)21(15)26/h2-9,15-16,19-22H,10-11H2,1H3/t15-,16-,19-,20+,21+,22+/m1/s1 |
| InChIKey | JUYPWMMOAJWJNI-DMAQGEDHSA-N |
| XLogP | 4.32 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|