C24H18Br2N2O7 — CID 124713056
[2-(3-nitrophenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124713056) has the molecular formula C24H18Br2N2O7 and a molecular weight of 606.22 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124713056 |
| Molecular Formula | C24H18Br2N2O7 |
| Molecular Weight | 606.22 g/mol |
| Exact Mass | 603.95 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@@H]3Br)[C@@H]2C1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18Br2N2O7/c25-20-14-9-15(21(20)26)19-18(14)22(30)27(23(19)31)16-7-2-1-6-13(16)24(32)35-10-17(29)11-4-3-5-12(8-11)28(33)34/h1-8,14-15,18-21H,9-10H2/t14-,15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | DHQXNEIZIICWBM-IGQFXSRTSA-N |
| XLogP | 3.92 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|