C20H18Br2N2O7 — CID 124628549
[2-(3-nitrophenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 124628549) has the molecular formula C20H18Br2N2O7 and a molecular weight of 558.18 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 124628549 |
| Molecular Formula | C20H18Br2N2O7 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O)OCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18Br2N2O7/c21-17-11-7-12(18(17)22)16-15(11)19(27)23(20(16)28)5-4-14(26)31-8-13(25)9-2-1-3-10(6-9)24(29)30/h1-3,6,11-12,15-18H,4-5,7-8H2/t11-,12-,15-,16-,17+,18+/m1/s1 |
| InChIKey | QDZVRYZXQJLZSI-YULKNUEKSA-N |
| XLogP | 2.49 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|