C27H22Br3NO7 — CID 19645530
[4-[2-[3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoyloxy]acetyl]phenyl] 4-bromobenzoate (PubChem CID 19645530) has the molecular formula C27H22Br3NO7 and a molecular weight of 712.19 g/mol. Its IUPAC name is [4-[2-[3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoyloxy]acetyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[2-[3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoyloxy]acetyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 19645530 |
| Molecular Formula | C27H22Br3NO7 |
| Molecular Weight | 712.19 g/mol |
| Exact Mass | 708.89 |
| IUPAC Name | [4-[2-[3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoyloxy]acetyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(CCN1C(=O)C2C3CC(C(Br)C3Br)C2C1=O)OCC(=O)c1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H22Br3NO7/c28-15-5-1-14(2-6-15)27(36)38-16-7-3-13(4-8-16)19(32)12-37-20(33)9-10-31-25(34)21-17-11-18(22(21)26(31)35)24(30)23(17)29/h1-8,17-18,21-24H,9-12H2 |
| InChIKey | BKJLDUUHGHZBAM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|