C22H23Br2NO5 — CID 3121325
[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoate (PubChem CID 3121325) has the molecular formula C22H23Br2NO5 and a molecular weight of 541.24 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoate |
|---|---|
| PubChem CID | 3121325 |
| Molecular Formula | C22H23Br2NO5 |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)CCN2C(=O)C3C4CC(C(Br)C4Br)C3C2=O)c1 |
| InChI | InChI=1S/C22H23Br2NO5/c1-10-3-4-11(2)12(7-10)15(26)9-30-16(27)5-6-25-21(28)17-13-8-14(18(17)22(25)29)20(24)19(13)23/h3-4,7,13-14,17-20H,5-6,8-9H2,1-2H3 |
| InChIKey | CVSLOFTYQTXNNZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|