C21H21Br2NO5 — CID 98120719
[2-(4-methylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 98120719) has the molecular formula C21H21Br2NO5 and a molecular weight of 527.21 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 98120719 |
| Molecular Formula | C21H21Br2NO5 |
| Molecular Weight | 527.21 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CCN2C(=O)[C@H]3[C@@H]4C[C@H]([C@@H](Br)[C@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H21Br2NO5/c1-10-2-4-11(5-3-10)14(25)9-29-15(26)6-7-24-20(27)16-12-8-13(17(16)21(24)28)19(23)18(12)22/h2-5,12-13,16-19H,6-9H2,1H3/t12-,13-,16-,17-,18-,19+/m0/s1 |
| InChIKey | ROIGSQZNJHPUNL-IPWHYPCCSA-N |
| XLogP | 2.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|