C20H19Br2NO5 — CID 124714302
[2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 124714302) has the molecular formula C20H19Br2NO5 and a molecular weight of 513.18 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 124714302 |
| Molecular Formula | C20H19Br2NO5 |
| Molecular Weight | 513.18 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | Cc1ccc(C(=O)COC(=O)CN2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H19Br2NO5/c1-9-2-4-10(5-3-9)13(24)8-28-14(25)7-23-19(26)15-11-6-12(16(15)20(23)27)18(22)17(11)21/h2-5,11-12,15-18H,6-8H2,1H3/t11-,12-,15-,16+,17+,18+/m1/s1 |
| InChIKey | JYUPQIOPAAMHFO-HPKFOSBRSA-N |
| XLogP | 2.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|