C23H18Br2N2O7 — CID 6566634
[2-(3-nitrophenyl)-2-oxoethyl] 2-[(3aS,5S,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 6566634) has the molecular formula C23H18Br2N2O7 and a molecular weight of 594.21 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-[(3aS,5S,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(3aS,5S,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 6566634 |
| Molecular Formula | C23H18Br2N2O7 |
| Molecular Weight | 594.21 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(3aS,5S,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)[C@H]2C[C@@H](Br)[C@@H](Br)C[C@@H]2C1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18Br2N2O7/c24-17-9-15-16(10-18(17)25)22(30)26(21(15)29)19-7-2-1-6-14(19)23(31)34-11-20(28)12-4-3-5-13(8-12)27(32)33/h1-8,15-18H,9-11H2/t15-,16-,17-,18+/m0/s1 |
| InChIKey | HNLNAKIIIWOODI-XLAORIBOSA-N |
| XLogP | 4.06 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|