C25H23NO6 — CID 40735609
[2-(4-methoxyphenyl)-2-oxoethyl] 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 40735609) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 40735609 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccccc2N2C(=O)[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-31-17-10-8-14(9-11-17)20(27)13-32-25(30)18-4-2-3-5-19(18)26-23(28)21-15-6-7-16(12-15)22(21)24(26)29/h2-5,8-11,15-16,21-22H,6-7,12-13H2,1H3/t15-,16+,21-,22+ |
| InChIKey | GBHRMHTUHMCRIN-NLZGTENKSA-N |
| XLogP | 3.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|