C31H27NO6 — CID 124715647
[(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124715647) has the molecular formula C31H27NO6 and a molecular weight of 509.56 g/mol. Its IUPAC name is [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124715647 |
| Molecular Formula | C31H27NO6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | COc1ccc(C(=O)[C@H](OC(=O)c2ccccc2N2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@H]3C2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27NO6/c1-37-22-15-13-18(14-16-22)27(33)28(19-7-3-2-4-8-19)38-31(36)23-9-5-6-10-24(23)32-29(34)25-20-11-12-21(17-20)26(25)30(32)35/h2-10,13-16,20-21,25-26,28H,11-12,17H2,1H3/t20-,21-,25+,26+,28+/m0/s1 |
| InChIKey | PGFTXCKGHMGHOM-YEONGNJVSA-N |
| XLogP | 5.01 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|