C31H22ClNO7 — CID 126183804
[(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate (PubChem CID 126183804) has the molecular formula C31H22ClNO7 and a molecular weight of 555.97 g/mol. Its IUPAC name is [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate.
| Compound Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 126183804 |
| Molecular Formula | C31H22ClNO7 |
| Molecular Weight | 555.97 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
| SMILES | COc1ccc(C(=O)[C@H](OC(=O)c2cc(Cl)c(N3C(=O)c4ccccc4C3=O)cc2OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H22ClNO7/c1-38-20-14-12-18(13-15-20)27(34)28(19-8-4-3-5-9-19)40-31(37)23-16-24(32)25(17-26(23)39-2)33-29(35)21-10-6-7-11-22(21)30(33)36/h3-17,28H,1-2H3/t28-/m1/s1 |
| InChIKey | GUPBMDFBKSNDGI-MUUNZHRXSA-N |
| XLogP | 5.94 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|