C29H19ClN2O7 — CID 126187581
benzhydryl 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126187581) has the molecular formula C29H19ClN2O7 and a molecular weight of 542.93 g/mol. Its IUPAC name is benzhydryl 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | benzhydryl 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126187581 |
| Molecular Formula | C29H19ClN2O7 |
| Molecular Weight | 542.93 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | benzhydryl 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COc1cc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(Cl)cc1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H19ClN2O7/c1-38-24-16-23(31-27(33)19-13-8-14-22(32(36)37)25(19)28(31)34)21(30)15-20(24)29(35)39-26(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-16,26H,1H3 |
| InChIKey | AXCYCFIYQSLPGE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|