C16H10N2O6 — CID 765591
[2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate (PubChem CID 765591) has the molecular formula C16H10N2O6 and a molecular weight of 326.26 g/mol. Its IUPAC name is [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate.
| Compound Name | [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 765591 |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C16H10N2O6/c1-9(19)24-13-8-3-2-6-11(13)17-15(20)10-5-4-7-12(18(22)23)14(10)16(17)21/h2-8H,1H3 |
| InChIKey | XENPBKONCCVRIF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|