C17H10N2O6 — CID 5142305
[4-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] prop-2-enoate (PubChem CID 5142305) has the molecular formula C17H10N2O6 and a molecular weight of 338.28 g/mol. Its IUPAC name is [4-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] prop-2-enoate.
| Compound Name | [4-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 5142305 |
| Molecular Formula | C17H10N2O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [4-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C17H10N2O6/c1-2-14(20)25-11-8-6-10(7-9-11)18-16(21)12-4-3-5-13(19(23)24)15(12)17(18)22/h2-9H,1H2 |
| InChIKey | RXHJELABSUSYRH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|