C16H11BrN2O4 — CID 1291235
2-(4-bromo-3,5-dimethylphenyl)-4-nitroisoindole-1,3-dione (PubChem CID 1291235) has the molecular formula C16H11BrN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenyl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(4-bromo-3,5-dimethylphenyl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 1291235 |
| Molecular Formula | C16H11BrN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenyl)-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc(C)c1Br |
| InChI | InChI=1S/C16H11BrN2O4/c1-8-6-10(7-9(2)14(8)17)18-15(20)11-4-3-5-12(19(22)23)13(11)16(18)21/h3-7H,1-2H3 |
| InChIKey | CEUILWDKYBUPFT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|