C18H11N3O4 — CID 4584182
2-(2-methylquinolin-4-yl)-4-nitroisoindole-1,3-dione (PubChem CID 4584182) has the molecular formula C18H11N3O4 and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-(2-methylquinolin-4-yl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(2-methylquinolin-4-yl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4584182 |
| Molecular Formula | C18H11N3O4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(2-methylquinolin-4-yl)-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c2ccccc2n1 |
| InChI | InChI=1S/C18H11N3O4/c1-10-9-15(11-5-2-3-7-13(11)19-10)20-17(22)12-6-4-8-14(21(24)25)16(12)18(20)23/h2-9H,1H3 |
| InChIKey | GQHPHMUMDTUGON-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|