C22H11N3O6 — CID 1364790
4-nitro-2-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 1364790) has the molecular formula C22H11N3O6 and a molecular weight of 413.35 g/mol. Its IUPAC name is 4-nitro-2-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1364790 |
| Molecular Formula | C22H11N3O6 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-nitro-2-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1c1cccc(-c2nc3ccccc3c(=O)o2)c1 |
| InChI | InChI=1S/C22H11N3O6/c26-20-15-8-4-10-17(25(29)30)18(15)21(27)24(20)13-6-3-5-12(11-13)19-23-16-9-2-1-7-14(16)22(28)31-19/h1-11H |
| InChIKey | UXRMSYYOUXRBFM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 123.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|