C21H11ClN2O3 — CID 132797663
2-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 132797663) has the molecular formula C21H11ClN2O3 and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132797663 |
| Molecular Formula | C21H11ClN2O3 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2nc3cc(Cl)ccc3o2)c1 |
| InChI | InChI=1S/C21H11ClN2O3/c22-13-8-9-18-17(11-13)23-19(27-18)12-4-3-5-14(10-12)24-20(25)15-6-1-2-7-16(15)21(24)26/h1-11H |
| InChIKey | CWYGNIBUOQHLBV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|