C17H11ClN2O — CID 91677456
5-chloro-2-(3-pyrrol-1-ylphenyl)-1,3-benzoxazole (PubChem CID 91677456) has the molecular formula C17H11ClN2O and a molecular weight of 294.74 g/mol. Its IUPAC name is 5-chloro-2-(3-pyrrol-1-ylphenyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(3-pyrrol-1-ylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 91677456 |
| Molecular Formula | C17H11ClN2O |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-chloro-2-(3-pyrrol-1-ylphenyl)-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(-c3cccc(-n4cccc4)c3)nc2c1 |
| InChI | InChI=1S/C17H11ClN2O/c18-13-6-7-16-15(11-13)19-17(21-16)12-4-3-5-14(10-12)20-8-1-2-9-20/h1-11H |
| InChIKey | KPZJMEAYPZRMJN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |