C22H13N3O3 — CID 19324413
2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]isoindole-1,3-dione (PubChem CID 19324413) has the molecular formula C22H13N3O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19324413 |
| Molecular Formula | C22H13N3O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2nc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C22H13N3O3/c26-21-17-11-4-5-12-18(17)22(27)25(21)16-10-6-9-15(13-16)20-23-19(24-28-20)14-7-2-1-3-8-14/h1-13H |
| InChIKey | HLIWIFVIJIBWFU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|