C17H12N4O2 — CID 168516694
2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]isoindole-1,3-dione (PubChem CID 168516694) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516694 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1nc(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)n[nH]1 |
| InChI | InChI=1S/C17H12N4O2/c1-10-18-15(20-19-10)11-5-4-6-12(9-11)21-16(22)13-7-2-3-8-14(13)17(21)23/h2-9H,1H3,(H,18,19,20) |
| InChIKey | CZENHZCZOLCEQE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|