C22H15N3O2 — CID 168518429
2-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518429) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518429 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1cccn2cc(-c3cccc(N4C(=O)c5ccccc5C4=O)c3)nc12 |
| InChI | InChI=1S/C22H15N3O2/c1-14-6-5-11-24-13-19(23-20(14)24)15-7-4-8-16(12-15)25-21(26)17-9-2-3-10-18(17)22(25)27/h2-13H,1H3 |
| InChIKey | WONUKNACILBLLB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|