C18H19N3O2S — CID 935997
8-methyl-2-(3-pyrrolidin-1-ylsulfonylphenyl)imidazo[1,2-a]pyridine (PubChem CID 935997) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 8-methyl-2-(3-pyrrolidin-1-ylsulfonylphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-2-(3-pyrrolidin-1-ylsulfonylphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 935997 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 8-methyl-2-(3-pyrrolidin-1-ylsulfonylphenyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(-c3cccc(S(=O)(=O)N4CCCC4)c3)nc12 |
| InChI | InChI=1S/C18H19N3O2S/c1-14-6-5-9-20-13-17(19-18(14)20)15-7-4-8-16(12-15)24(22,23)21-10-2-3-11-21/h4-9,12-13H,2-3,10-11H2,1H3 |
| InChIKey | ONQHKYKQNHZHJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |