About N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide
N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide (PubChem CID 122284339) has the molecular formula C17H17N3O2S
and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide |
| PubChem CID | 122284339 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide |
| SMILES | Cc1cccn2cc(-c3cccc(NS(=O)(=O)C4CC4)c3)nc12 |
| InChI | InChI=1S/C17H17N3O2S/c1-12-4-3-9-20-11-16(18-17(12)20)13-5-2-6-14(10-13)19-23(21,22)15-7-8-15/h2-6,9-11,15,19H,7-8H2,1H3 |
| InChIKey | YAPWMKXANAIKQN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide?
The IUPAC name of N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide (CID 122284339) is N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide.
What is the SMILES notation for N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide?
The canonical SMILES for N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide is Cc1cccn2cc(-c3cccc(NS(=O)(=O)C4CC4)c3)nc12.
What is the InChIKey of N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide?
The InChIKey is YAPWMKXANAIKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2S/c1-12-4-3-9-20-11-16(18-17(12)20)13-5-2-6-14(10-13)19-23(21,22)15-7-8-15/h2-6,9-11,15,19H,7-8H2,1H3.
What are the key properties of N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide?
N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide has a molecular weight of 327.41 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]cyclopropanesulfonamide is sourced from PubChem (CID 122284339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).