C15H15N2P — CID 145408974
methyl-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]phosphane (PubChem CID 145408974) has the molecular formula C15H15N2P and a molecular weight of 254.27 g/mol. Its IUPAC name is methyl-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]phosphane.
| Compound Name | methyl-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 145408974 |
| Molecular Formula | C15H15N2P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]phosphane |
| SMILES | CPc1cccc(-c2cn3cccc(C)c3n2)c1 |
| InChI | InChI=1S/C15H15N2P/c1-11-5-4-8-17-10-14(16-15(11)17)12-6-3-7-13(9-12)18-2/h3-10,18H,1-2H3 |
| InChIKey | LGIBTKFIRVQCRM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|