C20H20N2O2S2 — CID 1034342
2-phenyl-4-(3-piperidin-1-ylsulfonylphenyl)-1,3-thiazole (PubChem CID 1034342) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-phenyl-4-(3-piperidin-1-ylsulfonylphenyl)-1,3-thiazole.
| Compound Name | 2-phenyl-4-(3-piperidin-1-ylsulfonylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 1034342 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-phenyl-4-(3-piperidin-1-ylsulfonylphenyl)-1,3-thiazole |
| SMILES | O=S(=O)(c1cccc(-c2csc(-c3ccccc3)n2)c1)N1CCCCC1 |
| InChI | InChI=1S/C20H20N2O2S2/c23-26(24,22-12-5-2-6-13-22)18-11-7-10-17(14-18)19-15-25-20(21-19)16-8-3-1-4-9-16/h1,3-4,7-11,14-15H,2,5-6,12-13H2 |
| InChIKey | DPISMSORJHNNQS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |