C21H21ClN2O2S2 — CID 5121122
4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4-chlorophenyl)-1,3-thiazole (PubChem CID 5121122) has the molecular formula C21H21ClN2O2S2 and a molecular weight of 433.00 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4-chlorophenyl)-1,3-thiazole.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 5121122 |
| Molecular Formula | C21H21ClN2O2S2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4-chlorophenyl)-1,3-thiazole |
| SMILES | O=S(=O)(c1ccc(-c2csc(-c3ccc(Cl)cc3)n2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C21H21ClN2O2S2/c22-18-9-5-17(6-10-18)21-23-20(15-27-21)16-7-11-19(12-8-16)28(25,26)24-13-3-1-2-4-14-24/h5-12,15H,1-4,13-14H2 |
| InChIKey | OVJJHRRFPGPDCT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |