C20H20ClN3O2S2 — CID 30463446
2-[[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-4-phenyl-1,3-thiazole (PubChem CID 30463446) has the molecular formula C20H20ClN3O2S2 and a molecular weight of 433.99 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 30463446 |
| Molecular Formula | C20H20ClN3O2S2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-4-phenyl-1,3-thiazole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(Cc2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2S2/c21-17-6-8-18(9-7-17)28(25,26)24-12-10-23(11-13-24)14-20-22-19(15-27-20)16-4-2-1-3-5-16/h1-9,15H,10-14H2 |
| InChIKey | DHDKAYOVFXXVCD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |