C21H21ClN4O4S2 — CID 30463630
4-(4-chlorophenyl)-2-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazole (PubChem CID 30463630) has the molecular formula C21H21ClN4O4S2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-2-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 30463630 |
| Molecular Formula | C21H21ClN4O4S2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(Cc2nc(-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C21H21ClN4O4S2/c1-15-2-7-18(26(27)28)12-20(15)32(29,30)25-10-8-24(9-11-25)13-21-23-19(14-31-21)16-3-5-17(22)6-4-16/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | KIQNADHQVUDVDC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|