C20H20N6O7S — CID 55735194
5-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 55735194) has the molecular formula C20H20N6O7S and a molecular weight of 488.48 g/mol. Its IUPAC name is 5-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55735194 |
| Molecular Formula | C20H20N6O7S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5-[[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(Cc2nc(-c3ccc([N+](=O)[O-])cc3)no2)CC1 |
| InChI | InChI=1S/C20H20N6O7S/c1-14-2-5-17(26(29)30)12-18(14)34(31,32)24-10-8-23(9-11-24)13-19-21-20(22-33-19)15-3-6-16(7-4-15)25(27)28/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | KOSHCHAZJUCNFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 165.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|