C15H19N5O5S — CID 87015287
N-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-4-yl]methanesulfonamide (PubChem CID 87015287) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 87015287 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(Cc2nc(-c3ccc([N+](=O)[O-])cc3)no2)CC1 |
| InChI | InChI=1S/C15H19N5O5S/c1-26(23,24)18-12-6-8-19(9-7-12)10-14-16-15(17-25-14)11-2-4-13(5-3-11)20(21)22/h2-5,12,18H,6-10H2,1H3 |
| InChIKey | LBHCQWATWWYISV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|