C17H22N4O4 — CID 111332122
1-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-2-yl]propan-1-ol (PubChem CID 111332122) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-2-yl]propan-1-ol.
| Compound Name | 1-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 111332122 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidin-2-yl]propan-1-ol |
| SMILES | CCC(O)C1CCCCN1Cc1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C17H22N4O4/c1-2-15(22)14-5-3-4-10-20(14)11-16-18-17(19-25-16)12-6-8-13(9-7-12)21(23)24/h6-9,14-15,22H,2-5,10-11H2,1H3 |
| InChIKey | QTHMBKLKVHZYRI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|