C22H22FN5O4 — CID 38152069
1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methyl-3-nitrophenyl)piperidine-4-carboxamide (PubChem CID 38152069) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methyl-3-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methyl-3-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38152069 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methyl-3-nitrophenyl)piperidine-4-carboxamide |
| SMILES | Cc1c(NC(=O)C2CCN(Cc3nc(-c4ccc(F)cc4)no3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22FN5O4/c1-14-18(3-2-4-19(14)28(30)31)24-22(29)16-9-11-27(12-10-16)13-20-25-21(26-32-20)15-5-7-17(23)8-6-15/h2-8,16H,9-13H2,1H3,(H,24,29) |
| InChIKey | YWEIOFXOFQTQDU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|