C21H19Cl2N5O4 — CID 38157737
N-(2-chloro-5-nitrophenyl)-1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 38157737) has the molecular formula C21H19Cl2N5O4 and a molecular weight of 476.32 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38157737 |
| Molecular Formula | C21H19Cl2N5O4 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1 |
| InChI | InChI=1S/C21H19Cl2N5O4/c22-15-3-1-13(2-4-15)20-25-19(32-26-20)12-27-9-7-14(8-10-27)21(29)24-18-11-16(28(30)31)5-6-17(18)23/h1-6,11,14H,7-10,12H2,(H,24,29) |
| InChIKey | CVHJUVUTLXWWCY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|