C25H28ClN5O4 — CID 43932158
1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-chloro-5-nitrophenyl)piperidine-3-carboxamide (PubChem CID 43932158) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-chloro-5-nitrophenyl)piperidine-3-carboxamide.
| Compound Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-chloro-5-nitrophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43932158 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-chloro-5-nitrophenyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2noc(CN3CCCC(C(=O)Nc4cc([N+](=O)[O-])ccc4Cl)C3)n2)cc1 |
| InChI | InChI=1S/C25H28ClN5O4/c1-25(2,3)18-8-6-16(7-9-18)23-28-22(35-29-23)15-30-12-4-5-17(14-30)24(32)27-21-13-19(31(33)34)10-11-20(21)26/h6-11,13,17H,4-5,12,14-15H2,1-3H3,(H,27,32) |
| InChIKey | IVBKHRQLEXEPLM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|